Products 1403381-77-0

CAS 1403381-77-0 is the registry number for 2-Bromo-3-cyano-6-fluorobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-3-cyano-6-fluorobenzoic acid (CAS 1403381-77-0) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 2-bromo-3-cyano-6-fluorobenzoic acid. InChIKey: OGUNLOUDMMREBF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3BrFNO2
Molecular weight244.02 g/mol
IUPAC name2-bromo-3-cyano-6-fluorobenzoic acid
InChIKeyOGUNLOUDMMREBF-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C#N)Br)C(=O)O)F

Computed by PubChem (NCBI)