cas: 2230481-36-2 — see every product listed under this CAS number, including other names
5-Bromo-N-cyclopropyl-3-methylpicolinamide, 98% (CAS 2230481-36-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1632858-10g |
| cas | 2230481-36-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12172.09 Pln | |
| AmBeed | 5g | 7178.92 Pln | |
| AmBeed | 25g | 23851.03 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-N-cyclopropyl-3-methylpyridine-2-carboxamide (CAS 2230481-36-2) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 5-bromo-N-cyclopropyl-3-methylpyridine-2-carboxamide. InChIKey: SGMVWTXCYXEVMR-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 5-bromo-N-cyclopropyl-3-methylpyridine-2-carboxamide |
| InChIKey | SGMVWTXCYXEVMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)NC2CC2)Br |
Computed by PubChem (NCBI)