CAS 877679-22-6 appears in our catalog under these names: 1-(4-Bromophenyl)piperazin-2-one hydrochloride, 95%, 1-(4-Bromo-phenyl)-piperazin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-(4-bromophenyl)piperazin-2-one (CAS 877679-22-6) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 1-(4-bromophenyl)piperazin-2-one. InChIKey: WORBLAPBQYNWAU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)piperazin-2-one |
| InChIKey | WORBLAPBQYNWAU-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)