CAS 885275-22-9 is the registry number for 1-(2-Bromophenyl)piperazin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-(2-bromophenyl)piperazin-2-one (CAS 885275-22-9) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 1-(2-bromophenyl)piperazin-2-one. InChIKey: OHSOSFQRIWWQQV-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(2-bromophenyl)piperazin-2-one |
| InChIKey | OHSOSFQRIWWQQV-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)