CAS 958292-28-9 is the registry number for 3-Amino-7-bromo-2,3,4,5-tetrahydro-1h-1-benzazepin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-amino-7-bromo-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 958292-28-9) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 3-amino-7-bromo-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: MLCIKXLZQSZZQS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 3-amino-7-bromo-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | MLCIKXLZQSZZQS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)NC(=O)C1N |
Computed by PubChem (NCBI)