CAS 1283176-17-9 is the registry number for 2H-Benzimidazol-2-one, 4-bromo-1,3-dihydro-1-(1-methylethyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-bromo-3-propan-2-yl-1H-benzimidazol-2-one (CAS 1283176-17-9) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 7-bromo-3-propan-2-yl-1H-benzimidazol-2-one. InChIKey: NPJFNKBBMIGJMK-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 7-bromo-3-propan-2-yl-1H-benzimidazol-2-one |
| InChIKey | NPJFNKBBMIGJMK-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C(=CC=C2)Br)NC1=O |
Computed by PubChem (NCBI)