cas: 73866-23-6 — see every product listed under this CAS number, including other names
5-Bromoacetyl salicylamide 95% (CAS 73866-23-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A303454-25g |
| cas | 73866-23-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A303454 |
5-(2-bromoacetyl)-2-hydroxybenzamide (CAS 73866-23-6) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 5-(2-bromoacetyl)-2-hydroxybenzamide. InChIKey: VXWSXLSUWGZOHD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 5-(2-bromoacetyl)-2-hydroxybenzamide |
| InChIKey | VXWSXLSUWGZOHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)C(=O)N)O |
Computed by PubChem (NCBI)