cas: 7312-24-5 — see every product listed under this CAS number, including other names
5-Bromobenzo[b]thiophene-3-carboxylic acid, 97% (CAS 7312-24-5) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC33501CB |
| cas | 7312-24-5 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 529.44 Pln | |
| Thermo Scientific | 1g | 1058.89 Pln | |
| Thermo Scientific | 5g | 2041.41 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-bromo-1-benzothiophene-3-carboxylic acid (CAS 7312-24-5) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 5-bromo-1-benzothiophene-3-carboxylic acid. InChIKey: DWQBOPASRUUSKR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-bromo-1-benzothiophene-3-carboxylic acid |
| InChIKey | DWQBOPASRUUSKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)