cas: 7312-24-5 — see every product listed under this CAS number, including other names
5-Bromobenzo[b]thiophene-3-carboxylic acid, 98%, 98% (CAS 7312-24-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1174TI-25g |
| cas | 7312-24-5 |
| size | 25g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 3400.40 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 755.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-benzothiophene-3-carboxylic acid (CAS 7312-24-5) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 5-bromo-1-benzothiophene-3-carboxylic acid. InChIKey: DWQBOPASRUUSKR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-bromo-1-benzothiophene-3-carboxylic acid |
| InChIKey | DWQBOPASRUUSKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)