Products 54904-23-3
CAS 54904-23-3 appears in our catalog under these names: 5–Bromoindol–3–propionic acid, 5-Bromo-indol-3-propionic acid, 5-Bromoindol-3-propionic acid, 97%, 97%, 5-Bromo-Indol-3-propionic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 50mg, 250mg, 1g, 5g.
3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 54904-23-3) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: DRCUGRYTGTWNRN-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | DRCUGRYTGTWNRN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-bromo-1H-indol-3-yl)propanoic acid, 5-Bromo-Indol-3-propionic acid, 5-Bromoindol-3-propionic acid, 3-(5-bromo-1h-indol-3-yl)-propionic acid, 3-(5-Bromo-3-indolyl)propanoic Acid, 5-bromoindole-3-propionic acid, 1H-Indole-3-propanoic acid, 5-bromo-, 5-Bromo-1H-indole-3-propanoic acid, Oprea1_305302, 5-Bromoindol-3-propionicacid