CAS 40432-84-6 appears in our catalog under these names: 5–Bromoindole–3–acetic acid, 5-Bromoindole-3-acetic acid, 97% , 2-(5-Bromo-1H-indol-3-yl)acetic acid 95%, 2-(5-Bromo-1H-indol-3-yl)acetic acid, 97%, 97%, (5-Bromo-1H-indol-3-yl)-acetic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 250mg, 10g.
2-(5-bromo-1H-indol-3-yl)acetic acid (CAS 40432-84-6) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(5-bromo-1H-indol-3-yl)acetic acid. InChIKey: WTFGHMZUJMRWBK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(5-bromo-1H-indol-3-yl)acetic acid |
| InChIKey | WTFGHMZUJMRWBK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)