cas: 1198-14-7 — see every product listed under this CAS number, including other names
5-Bromoquinolin-8-ol 95% (CAS 1198-14-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A309091-500g |
| cas | 1198-14-7 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 16306.94 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 620.69 Pln | |
| Ambeed | 25g | 1299.31 Pln | |
| Ambeed | 100g | 4130.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A309091 |
5-bromoquinolin-8-ol (CAS 1198-14-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-bromoquinolin-8-ol. InChIKey: WIIUANWSGSTCLG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-bromoquinolin-8-ol |
| InChIKey | WIIUANWSGSTCLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)Br |
Computed by PubChem (NCBI)