CAS 1198-14-7 appears in our catalog under these names: 5–Bromo–8–hydroxyquinoline, 5-Bromo-8-hydroxyquinoline, >96.0%(GC), 5-Bromoquinolin-8-ol 95%, 5-Bromoquinolin-8-ol, 98%, 98%, 5-Bromoquinolin-8-ol, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 250mg, 1g, 10g, 100g.
5-bromoquinolin-8-ol (CAS 1198-14-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-bromoquinolin-8-ol. InChIKey: WIIUANWSGSTCLG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-bromoquinolin-8-ol |
| InChIKey | WIIUANWSGSTCLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)Br |
Computed by PubChem (NCBI)