cas: 52092-47-4 — see every product listed under this CAS number, including other names
5-CHLORO-2-NITROPYRIDINE, 97% (CAS 52092-47-4) is a chemical reagent available from Chemat. Available pack sizes: 5G, 10g, 25g, 100g, 500g. Offered by: Sigma-Aldrich, Fluorochem.
| brand | Sigma-Aldrich |
|---|---|
| catalog number | 714585-5G |
| cas | 52092-47-4 |
| size | 5G |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Sigma-Aldrich | 5G | 223.00 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 500g | 846.59 Pln |
| purity | No data |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-chloro-2-nitropyridine (CAS 52092-47-4) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 5-chloro-2-nitropyridine. InChIKey: YUBHMOQVHOODEI-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 5-chloro-2-nitropyridine |
| InChIKey | YUBHMOQVHOODEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)