cas: 52092-47-4 — see every product listed under this CAS number, including other names
5-Chloro-2-nitropyridine 97% (CAS 52092-47-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A345583-1g |
| cas | 52092-47-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 1037.88 Pln | |
| Ambeed | 1000g | 1722.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A345583 |
5-chloro-2-nitropyridine (CAS 52092-47-4) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 5-chloro-2-nitropyridine. InChIKey: YUBHMOQVHOODEI-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 5-chloro-2-nitropyridine |
| InChIKey | YUBHMOQVHOODEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)