cas: 16650-52-5 — see every product listed under this CAS number, including other names
5-Chloro-1-Naphthoic Acid, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 16650-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WSM-100mg |
| cas | 16650-52-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 1394.00 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
5-chloronaphthalene-1-carboxylic acid (CAS 16650-52-5) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 5-chloronaphthalene-1-carboxylic acid. InChIKey: CPGDMBASSDNQIS-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 5-chloronaphthalene-1-carboxylic acid |
| InChIKey | CPGDMBASSDNQIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Cl)C(=C1)C(=O)O |
Computed by PubChem (NCBI)