cas: 42098-25-9 — see every product listed under this CAS number, including other names
5-Chloro-1-methyl-4-nitro-1H-pyrazole 97% (CAS 42098-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111028-100mg |
| cas | 42098-25-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 2767.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111028 |
5-chloro-1-methyl-4-nitropyrazole (CAS 42098-25-9) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 5-chloro-1-methyl-4-nitropyrazole. InChIKey: POXLZEWCWNUVDW-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 5-chloro-1-methyl-4-nitropyrazole |
| InChIKey | POXLZEWCWNUVDW-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)