cas: 42098-25-9 — see every product listed under this CAS number, including other names
5-Chloro-1-methyl-4-nitro-1H-pyrazole, 97%, 97% (CAS 42098-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7L9-100mg |
| cas | 42098-25-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 712.40 Pln | |
| Chemat | 10g | 1336.40 Pln | |
| Chemat | 25g | 3093.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1-methyl-4-nitropyrazole (CAS 42098-25-9) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 5-chloro-1-methyl-4-nitropyrazole. InChIKey: POXLZEWCWNUVDW-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 5-chloro-1-methyl-4-nitropyrazole |
| InChIKey | POXLZEWCWNUVDW-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)