cas: 1015610-39-5 — see every product listed under this CAS number, including other names
5-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde, 98% (CAS 1015610-39-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050714-100MG |
| cas | 1015610-39-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 721.64 Pln | |
| Fluorochem | 500mg | 778.91 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 1408.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde (CAS 1015610-39-5) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde. InChIKey: PHZFFVFGFZWMFD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde |
| InChIKey | PHZFFVFGFZWMFD-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)C=O)Cl |
Computed by PubChem (NCBI)