5-Chloro-2'-deoxyuridine, 98%
cas: 50-90-8 — see every product listed under this CAS number, including other names
5-Chloro-2'-deoxyuridine, 98% (CAS 50-90-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A639135-250mg |
| cas | 50-90-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 2139.25 Pln | |
| Ambeed | 10g | 3652.25 Pln | |
| Ambeed | 25g | 7234.50 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| Chemat | 10g | 2810.00 Pln | |
| Chemat | 25g | 5402.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-chloro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 50-90-8) is a chemical compound with the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. IUPAC name: 5-chloro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: NJCXGFKPQSFZIB-RRKCRQDMSA-N.
| Molecular formula | C9H11ClN2O5 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 5-chloro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | NJCXGFKPQSFZIB-RRKCRQDMSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)Cl)CO)O |
Computed by PubChem (NCBI)