CAS 188559-94-6 is the registry number for 3'-epi-5-chloro-2'-deoxyuridine. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg.
5-chloro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 188559-94-6) is a chemical compound with the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. IUPAC name: 5-chloro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: NJCXGFKPQSFZIB-FSDSQADBSA-N.
| Molecular formula | C9H11ClN2O5 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 5-chloro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | NJCXGFKPQSFZIB-FSDSQADBSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)Cl)CO)O |
Computed by PubChem (NCBI)