CAS 69260-69-1 appears in our catalog under these names: Cytarabine Impurity 6, Cytarabine Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2R,3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 69260-69-1) is a chemical compound with the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. IUPAC name: 1-[(2R,3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: BQPRXEHWLMFKLL-CCXZUQQUSA-N.
| Molecular formula | C9H11ClN2O5 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 1-[(2R,3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | BQPRXEHWLMFKLL-CCXZUQQUSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@H]([C@@H]([C@H](O2)CCl)O)O |
Computed by PubChem (NCBI)