CAS 4753-04-2 appears in our catalog under these names: 2′-Chloro-2′-deoxyuridine, 2'-Chloro-2'-deoxyuridine, 95%, Uridine, 2'-chloro-2'-deoxy-, 95%, 95%. Offered by: MedChemExpress, Combi-blocks, Chemat. Available pack sizes: Get quote, 1g, 5g, 250mg.
1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 4753-04-2) is a chemical compound with the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: XOTUXDQKWDTKSI-XVFCMESISA-N.
| Molecular formula | C9H11ClN2O5 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | XOTUXDQKWDTKSI-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)Cl |
Computed by PubChem (NCBI)