CAS 19556-54-8 is the registry number for 5'-Chloro-5'-deoxyuridine. Offered by: TRC. Available pack sizes: 2,5g.
1-[5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 19556-54-8) is a chemical compound with the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. IUPAC name: 1-[5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: BQPRXEHWLMFKLL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O5 |
|---|---|
| Molecular weight | 262.65 g/mol |
| IUPAC name | 1-[5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | BQPRXEHWLMFKLL-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CCl)O)O |
Computed by PubChem (NCBI)