cas: 1132669-91-0 — see every product listed under this CAS number, including other names
5-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%, 98% (CAS 1132669-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11059Q-100mg |
| cas | 1132669-91-0 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 539.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1132669-91-0) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: JSGQMZRCRXFFKM-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | JSGQMZRCRXFFKM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)