cas: 1807339-23-6 — see every product listed under this CAS number, including other names
5-Chloro-2-(propan-2-yloxy)pyridine-3-carboxylic acid (CAS 1807339-23-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631708-250MG |
| cas | 1807339-23-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 5844.83 Pln | |
| Fluorochem | 500mg | 6625.81 Pln |
| delivery time | 3-4 weeks |
|---|
5-chloro-2-propan-2-yloxypyridine-3-carboxylic acid (CAS 1807339-23-6) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 5-chloro-2-propan-2-yloxypyridine-3-carboxylic acid. InChIKey: IWUNRYLASQNOMN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 5-chloro-2-propan-2-yloxypyridine-3-carboxylic acid |
| InChIKey | IWUNRYLASQNOMN-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)