CAS 190908-14-6 is the registry number for 1-Chloro-2-methoxy-4,5-dimethyl-3-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-chloro-2-methoxy-4,5-dimethyl-3-nitrobenzene (CAS 190908-14-6) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 1-chloro-2-methoxy-4,5-dimethyl-3-nitrobenzene. InChIKey: GOWCECJJUFPZFF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 1-chloro-2-methoxy-4,5-dimethyl-3-nitrobenzene |
| InChIKey | GOWCECJJUFPZFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)[N+](=O)[O-])OC)Cl |
Computed by PubChem (NCBI)