CAS 162599-96-4 appears in our catalog under these names: 3-Chloro-d-tyrosine, 95%, Fmoc-D-Aph(D-Hor)-OH. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg, 1000mg.
(2R)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid (CAS 162599-96-4) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: (2R)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid. InChIKey: ACWBBAGYTKWBCD-SSDOTTSWSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid |
| InChIKey | ACWBBAGYTKWBCD-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](C(=O)O)N)Cl)O |
Computed by PubChem (NCBI)