Products 162599-96-4

CAS 162599-96-4 appears in our catalog under these names: 3-Chloro-d-tyrosine, 95%, Fmoc-D-Aph(D-Hor)-OH. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid (CAS 162599-96-4) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: (2R)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid. InChIKey: ACWBBAGYTKWBCD-SSDOTTSWSA-N.

Identity
Molecular formulaC9H10ClNO3
Molecular weight215.63 g/mol
IUPAC name(2R)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid
InChIKeyACWBBAGYTKWBCD-SSDOTTSWSA-N
SMILESC1=CC(=C(C=C1C[C@H](C(=O)O)N)Cl)O

Computed by PubChem (NCBI)