Products 1037423-77-0

CAS 1037423-77-0 is the registry number for 2-(2-Chloro-4-methoxyphenyl)-dl-glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-2-(2-chloro-4-methoxyphenyl)acetic acid (CAS 1037423-77-0) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 2-amino-2-(2-chloro-4-methoxyphenyl)acetic acid. InChIKey: GVHKGEAFGVTYPN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3
Molecular weight215.63 g/mol
IUPAC name2-amino-2-(2-chloro-4-methoxyphenyl)acetic acid
InChIKeyGVHKGEAFGVTYPN-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C(C(=O)O)N)Cl

Computed by PubChem (NCBI)