Products 1803606-28-1
CAS 1803606-28-1 is the registry number for 4-Oxo-4-(pyridin-2-yl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-oxo-4-pyridin-2-ylbutanoic acid;hydrochloride (CAS 1803606-28-1) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 4-oxo-4-pyridin-2-ylbutanoic acid;hydrochloride. InChIKey: MERGXRUIQOIIEQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 4-oxo-4-pyridin-2-ylbutanoic acid;hydrochloride |
| InChIKey | MERGXRUIQOIIEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)CCC(=O)O.Cl |
Computed by PubChem (NCBI)