cas: 874821-52-0 — see every product listed under this CAS number, including other names
5-Chloro-2-(trifluoromethoxy)benzyl alcohol, 98% (CAS 874821-52-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F343015-100MG |
| cas | 874821-52-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 2793.83 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[5-chloro-2-(trifluoromethoxy)phenyl]methanol (CAS 874821-52-0) is a chemical compound with the molecular formula C8H6ClF3O2 and a molecular weight of 226.58 g/mol. IUPAC name: [5-chloro-2-(trifluoromethoxy)phenyl]methanol. InChIKey: JIVPVUAGDRWIBR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2 |
|---|---|
| Molecular weight | 226.58 g/mol |
| IUPAC name | [5-chloro-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | JIVPVUAGDRWIBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CO)OC(F)(F)F |
Computed by PubChem (NCBI)