CAS 2227862-41-9 is the registry number for (S)-5-Chloro-2-(2,2,2-trifluoro-1-hydroxyethyl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenol (CAS 2227862-41-9) is a chemical compound with the molecular formula C8H6ClF3O2 and a molecular weight of 226.58 g/mol. IUPAC name: 5-chloro-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenol. InChIKey: JRJRRCKIFYWRFT-ZETCQYMHSA-N.
| Molecular formula | C8H6ClF3O2 |
|---|---|
| Molecular weight | 226.58 g/mol |
| IUPAC name | 5-chloro-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenol |
| InChIKey | JRJRRCKIFYWRFT-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)[C@@H](C(F)(F)F)O |
Computed by PubChem (NCBI)