Products 56456-48-5
CAS 56456-48-5 appears in our catalog under these names: 3-Chloro-4-(trifluoromethoxy)benzyl alcohol, 98%, 3-Chloro-4-(trifluoromethoxy)benzyl alcohol, 98%, 98%, (3-Chloro-4-(trifluoromethoxy)phenyl)methanol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
[3-chloro-4-(trifluoromethoxy)phenyl]methanol (CAS 56456-48-5) is a chemical compound with the molecular formula C8H6ClF3O2 and a molecular weight of 226.58 g/mol. IUPAC name: [3-chloro-4-(trifluoromethoxy)phenyl]methanol. InChIKey: KPYSDIQXFHKDPU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2 |
|---|---|
| Molecular weight | 226.58 g/mol |
| IUPAC name | [3-chloro-4-(trifluoromethoxy)phenyl]methanol |
| InChIKey | KPYSDIQXFHKDPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)