Products 433926-47-7
CAS 433926-47-7 appears in our catalog under these names: 3-Chloro-5-(trifluoromethoxy)benzyl alcohol, 95%, 3-Chloro-5-(trifluoromethoxy)benzyl Alcohol, 3-Chloro-5-(trifluoromethoxy)benzyl alcohol, ≥95%. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 5g, 10g, 1g, 500mg.
[3-chloro-5-(trifluoromethoxy)phenyl]methanol (CAS 433926-47-7) is a chemical compound with the molecular formula C8H6ClF3O2 and a molecular weight of 226.58 g/mol. IUPAC name: [3-chloro-5-(trifluoromethoxy)phenyl]methanol. InChIKey: PZHLQGDDGUWVKH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2 |
|---|---|
| Molecular weight | 226.58 g/mol |
| IUPAC name | [3-chloro-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | PZHLQGDDGUWVKH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)CO |
Computed by PubChem (NCBI)