Products 874821-52-0
CAS 874821-52-0 appears in our catalog under these names: 5-Chloro-2-(trifluoromethoxy)benzyl alcohol, 97%, (5-Chloro-2-(trifluoromethoxy)phenyl)methanol, 98%, 5-Chloro-2-(trifluoromethoxy)benzyl alcohol, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
[5-chloro-2-(trifluoromethoxy)phenyl]methanol (CAS 874821-52-0) is a chemical compound with the molecular formula C8H6ClF3O2 and a molecular weight of 226.58 g/mol. IUPAC name: [5-chloro-2-(trifluoromethoxy)phenyl]methanol. InChIKey: JIVPVUAGDRWIBR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2 |
|---|---|
| Molecular weight | 226.58 g/mol |
| IUPAC name | [5-chloro-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | JIVPVUAGDRWIBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CO)OC(F)(F)F |
Computed by PubChem (NCBI)