cas: 352534-86-2 — see every product listed under this CAS number, including other names
5-Chloro-2-ethoxyphenylboronic acid, 98%, 98% (CAS 352534-86-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ECS-1g |
| cas | 352534-86-2 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 1029.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(5-chloro-2-ethoxyphenyl)boronic acid (CAS 352534-86-2) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (5-chloro-2-ethoxyphenyl)boronic acid. InChIKey: OSMBQNBPCSSVMT-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (5-chloro-2-ethoxyphenyl)boronic acid |
| InChIKey | OSMBQNBPCSSVMT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCC)(O)O |
Computed by PubChem (NCBI)