cas: 189283-52-1 — see every product listed under this CAS number, including other names
5-Chloro-4-fluoro-2-hydroxybenzoic acid 97% (CAS 189283-52-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102160-250mg |
| cas | 189283-52-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 960.00 Pln | |
| Ambeed | 25g | 1822.19 Pln | |
| Ambeed | 100g | 5571.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A102160 |
5-chloro-4-fluoro-2-hydroxybenzoic acid (CAS 189283-52-1) is a chemical compound with the molecular formula C7H4ClFO3 and a molecular weight of 190.55 g/mol. IUPAC name: 5-chloro-4-fluoro-2-hydroxybenzoic acid. InChIKey: DDRJDFULMKUQRV-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO3 |
|---|---|
| Molecular weight | 190.55 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-hydroxybenzoic acid |
| InChIKey | DDRJDFULMKUQRV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)O)C(=O)O |
Computed by PubChem (NCBI)