5-Chloro-4-fluoro-2-hydroxybenzoic acid, 97%
cas: 189283-52-1 — see every product listed under this CAS number, including other names
5-Chloro-4-fluoro-2-hydroxybenzoic acid, 97% (CAS 189283-52-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F363487-250MG |
| cas | 189283-52-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 2101.36 Pln | |
| Fluorochem | 100g | 8245.03 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-4-fluoro-2-hydroxybenzoic acid (CAS 189283-52-1) is a chemical compound with the molecular formula C7H4ClFO3 and a molecular weight of 190.55 g/mol. IUPAC name: 5-chloro-4-fluoro-2-hydroxybenzoic acid. InChIKey: DDRJDFULMKUQRV-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO3 |
|---|---|
| Molecular weight | 190.55 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-hydroxybenzoic acid |
| InChIKey | DDRJDFULMKUQRV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)O)C(=O)O |
Computed by PubChem (NCBI)