cas: 1261487-89-1 — see every product listed under this CAS number, including other names
5-Chloroquinolin-3-ol, 95%, 95% (CAS 1261487-89-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RST-100mg |
| cas | 1261487-89-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1370.00 Pln | |
| Chemat | 250mg | 2152.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloroquinolin-3-ol (CAS 1261487-89-1) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 5-chloroquinolin-3-ol. InChIKey: RFHPGQWORGIUFZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-chloroquinolin-3-ol |
| InChIKey | RFHPGQWORGIUFZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)O)C(=C1)Cl |
Computed by PubChem (NCBI)