cas: 635-27-8 — see every product listed under this CAS number, including other names
5-Chloroquinoline, 97% (CAS 635-27-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 100g. Offered by: Thermo Scientific (Acros), Ambeed.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 469740010 |
| cas | 635-27-8 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 204.90 Pln | |
| Thermo Scientific (Acros) | 5g | 792.89 Pln | |
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 10g | 531.69 Pln | |
| Ambeed | 100g | 2016.88 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-chloroquinoline (CAS 635-27-8) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 5-chloroquinoline. InChIKey: HJSRGOVAIOPERP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 5-chloroquinoline |
| InChIKey | HJSRGOVAIOPERP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=N2)C(=C1)Cl |
Computed by PubChem (NCBI)