CAS 5430-45-5 appears in our catalog under these names: 5-Chloroisoquinoline, 5–Chloroisoquinoline, 5-chloroisoquinoline, 98%, 5-Chloroisoquinoline, 95%, 5-Chloroisoquinoline, 98.0%. Offered by: TRC, GLPBio, Combi-blocks, AmBeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 1g, 5g, 10g, 25g, 250 mg.
5-chloroisoquinoline (CAS 5430-45-5) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 5-chloroisoquinoline. InChIKey: PJHSMEMFNSINJE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 5-chloroisoquinoline |
| InChIKey | PJHSMEMFNSINJE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)Cl |
Computed by PubChem (NCBI)