CAS 34784-07-1 appears in our catalog under these names: 8-Chloroisoquinoline, 97%, 8-Chloroisoquinoline, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
8-chloroisoquinoline (CAS 34784-07-1) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 8-chloroisoquinoline. InChIKey: OXAMVYYZTULFIB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 8-chloroisoquinoline |
| InChIKey | OXAMVYYZTULFIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)Cl |
Computed by PubChem (NCBI)