CAS 612-61-3 appears in our catalog under these names: 7-Chloroquinoline, >95% (HPLC), 7–Chloroquinoline, 7-Chloroquinoline, >98.0%(GC), 7-Chloroquinoline, 97%, 97%, 7-Chloroquinoline, 95%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 100g, 25g, 5g, 250mg, 10g, 500g.
7-chloroquinoline (CAS 612-61-3) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 7-chloroquinoline. InChIKey: QNGUPQRODVPRDC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 7-chloroquinoline |
| InChIKey | QNGUPQRODVPRDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Cl)N=C1 |
Computed by PubChem (NCBI)