CAS 611-35-8 appears in our catalog under these names: 4-Chloroquinoline, 99% , 4-Chloroquinoline, >97.0%(GC), 4-Chloroquinoline, 4-Chloroquinoline, 99%, Quinoline, 4-chloro-, 97%, 97%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Biosynth, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 5g, 0,5kg, 0,25kg, 1kg, 5kg, 10g, 25g.
4-chloroquinoline (CAS 611-35-8) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 4-chloroquinoline. InChIKey: KNDOFJFSHZCKGT-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 4-chloroquinoline |
| InChIKey | KNDOFJFSHZCKGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)Cl |
Computed by PubChem (NCBI)