cas: 1220696-43-4 — see every product listed under this CAS number, including other names
5-Cyclopropylpyridine-3-boronic acid pinacol ester, 95% (CAS 1220696-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627835-100MG |
| cas | 1220696-43-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1445.34 Pln | |
| Fluorochem | 250mg | 2132.60 Pln | |
| Fluorochem | 1g | 4183.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1220696-43-4) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 3-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ZEPYWCGUQASUDO-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 3-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ZEPYWCGUQASUDO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C3CC3 |
Computed by PubChem (NCBI)