5-Ethylindoline-2,3-dione, 98%
cas: 96202-56-1 — see every product listed under this CAS number, including other names
5-Ethylindoline-2,3-dione, 98% (CAS 96202-56-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A369013-250mg |
| cas | 96202-56-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1338.25 Pln | |
| Ambeed | 10g | 2295.00 Pln | |
| Ambeed | 25g | 4514.44 Pln | |
| BLDpharm | 250mg | 358.79 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1441.74 Pln | |
| BLDpharm | 10g | 2469.16 Pln | |
| BLDpharm | 25g | 4862.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-ethyl-1H-indole-2,3-dione (CAS 96202-56-1) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5-ethyl-1H-indole-2,3-dione. InChIKey: XDGNFZUIJHZHHP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5-ethyl-1H-indole-2,3-dione |
| InChIKey | XDGNFZUIJHZHHP-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)