Products 96202-56-1
CAS 96202-56-1 appears in our catalog under these names: 5-Ethyl-1H-indole-2,3-dione, 97%, 5-Ethylindoline-2,3-dione 98%, 5-Ethyl-1H-indole-2,3-dione, 98%, 98%, 5-Ethyl-1H-indole-2,3-dione, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 100mg.
5-ethyl-1H-indole-2,3-dione (CAS 96202-56-1) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5-ethyl-1H-indole-2,3-dione. InChIKey: XDGNFZUIJHZHHP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5-ethyl-1H-indole-2,3-dione |
| InChIKey | XDGNFZUIJHZHHP-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)