cas: 4840-63-5 — see every product listed under this CAS number, including other names
5-Ethylsulfonyl-2-methoxy-benzoic acid (CAS 4840-63-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609172-5G |
| cas | 4840-63-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 544.62 Pln | |
| Fluorochem | 25g | 1518.23 Pln | |
| Fluorochem | 100g | 4277.68 Pln |
| delivery time | 3-4 weeks |
|---|
5-ethylsulfonyl-2-methoxybenzoic acid (CAS 4840-63-5) is a chemical compound with the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. IUPAC name: 5-ethylsulfonyl-2-methoxybenzoic acid. InChIKey: NBFYWQQYIJTQQV-UHFFFAOYSA-N.
| Molecular formula | C10H12O5S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 5-ethylsulfonyl-2-methoxybenzoic acid |
| InChIKey | NBFYWQQYIJTQQV-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)