Products 1358967-53-9
CAS 1358967-53-9 is the registry number for Methyl 3-(hydroxymethyl)-5-(methylsulfonyl)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(hydroxymethyl)-5-methylsulfonylbenzoate (CAS 1358967-53-9) is a chemical compound with the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. IUPAC name: methyl 3-(hydroxymethyl)-5-methylsulfonylbenzoate. InChIKey: HOCPETBSEIFQMV-UHFFFAOYSA-N.
| Molecular formula | C10H12O5S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | methyl 3-(hydroxymethyl)-5-methylsulfonylbenzoate |
| InChIKey | HOCPETBSEIFQMV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)CO)S(=O)(=O)C |
Computed by PubChem (NCBI)