Products 1489702-46-6
CAS 1489702-46-6 is the registry number for 5-((Cyclobutylmethyl)sulfonyl)furan-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(cyclobutylmethylsulfonyl)furan-2-carboxylic acid (CAS 1489702-46-6) is a chemical compound with the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. IUPAC name: 5-(cyclobutylmethylsulfonyl)furan-2-carboxylic acid. InChIKey: GWTMBOAYOZWMFM-UHFFFAOYSA-N.
| Molecular formula | C10H12O5S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 5-(cyclobutylmethylsulfonyl)furan-2-carboxylic acid |
| InChIKey | GWTMBOAYOZWMFM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CS(=O)(=O)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)